C31H35N5O4 — CID 174701755
tert-butyl formate;4-(4-methylpiperazin-1-yl)-N-(4-phenylmethoxy-1,9-diazatricyclo[4.3.0.02,7]nona-2(7),3,5,8-tetraen-8-yl)benzamide (PubChem CID 174701755) has the molecular formula C31H35N5O4 and a molecular weight of 541.65 g/mol. Its IUPAC name is tert-butyl formate;4-(4-methylpiperazin-1-yl)-N-(4-phenylmethoxy-1,9-diazatricyclo[4.3.0.02,7]nona-2(7),3,5,8-tetraen-8-yl)benzamide.
| Compound Name | tert-butyl formate;4-(4-methylpiperazin-1-yl)-N-(4-phenylmethoxy-1,9-diazatricyclo[4.3.0.02,7]nona-2(7),3,5,8-tetraen-8-yl)benzamide |
|---|---|
| PubChem CID | 174701755 |
| Molecular Formula | C31H35N5O4 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | tert-butyl formate;4-(4-methylpiperazin-1-yl)-N-(4-phenylmethoxy-1,9-diazatricyclo[4.3.0.02,7]nona-2(7),3,5,8-tetraen-8-yl)benzamide |
| SMILES | CC(C)(C)OC=O.CN1CCN(c2ccc(C(=O)Nc3nn4c5cc(OCc6ccccc6)cc4c35)cc2)CC1 |
| InChI | InChI=1S/C26H25N5O2.C5H10O2/c1-29-11-13-30(14-12-29)20-9-7-19(8-10-20)26(32)27-25-24-22-15-21(16-23(24)31(22)28-25)33-17-18-5-3-2-4-6-18;1-5(2,3)7-4-6/h2-10,15-16H,11-14,17H2,1H3,(H,27,28,32);4H,1-3H3 |
| InChIKey | IFOZUDDRRSYOIN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|