C33H39N5O5 — CID 70983295
tert-butyl 3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-6-(2-phenylmethoxyethoxy)indazole-1-carboxylate (PubChem CID 70983295) has the molecular formula C33H39N5O5 and a molecular weight of 585.71 g/mol. Its IUPAC name is tert-butyl 3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-6-(2-phenylmethoxyethoxy)indazole-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-6-(2-phenylmethoxyethoxy)indazole-1-carboxylate |
|---|---|
| PubChem CID | 70983295 |
| Molecular Formula | C33H39N5O5 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | tert-butyl 3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-6-(2-phenylmethoxyethoxy)indazole-1-carboxylate |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3nn(C(=O)OC(C)(C)C)c4cc(OCCOCc5ccccc5)ccc34)cc2)CC1 |
| InChI | InChI=1S/C33H39N5O5/c1-33(2,3)43-32(40)38-29-22-27(42-21-20-41-23-24-8-6-5-7-9-24)14-15-28(29)30(35-38)34-31(39)25-10-12-26(13-11-25)37-18-16-36(4)17-19-37/h5-15,22H,16-21,23H2,1-4H3,(H,34,35,39) |
| InChIKey | VUYBISLVHIMZOU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|