C26H41N3O4 — CID 142608117
ethane;4-[2-(2-hydroxyethoxy)ethoxy]-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide (PubChem CID 142608117) has the molecular formula C26H41N3O4 and a molecular weight of 459.63 g/mol. Its IUPAC name is ethane;4-[2-(2-hydroxyethoxy)ethoxy]-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | ethane;4-[2-(2-hydroxyethoxy)ethoxy]-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 142608117 |
| Molecular Formula | C26H41N3O4 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | ethane;4-[2-(2-hydroxyethoxy)ethoxy]-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
| SMILES | CC.CC.CN1CCN(c2ccc(NC(=O)c3ccc(OCCOCCO)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H29N3O4.2C2H6/c1-24-10-12-25(13-11-24)20-6-4-19(5-7-20)23-22(27)18-2-8-21(9-3-18)29-17-16-28-15-14-26;2*1-2/h2-9,26H,10-17H2,1H3,(H,23,27);2*1-2H3 |
| InChIKey | ANNJFKCHGDDMTP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|