About tert-butyl formate;3-fluoro-2H-indazole
tert-butyl formate;3-fluoro-2H-indazole (PubChem CID 158237907) has the molecular formula C12H15FN2O2
and a molecular weight of 238.26 g/mol. Its IUPAC name is tert-butyl formate;3-fluoro-2H-indazole.
Molecular Properties
| Compound Name | tert-butyl formate;3-fluoro-2H-indazole |
| PubChem CID | 158237907 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | tert-butyl formate;3-fluoro-2H-indazole |
| SMILES | CC(C)(C)OC=O.Fc1[nH]nc2ccccc12 |
| InChI | InChI=1S/C7H5FN2.C5H10O2/c8-7-5-3-1-2-4-6(5)9-10-7;1-5(2,3)7-4-6/h1-4H,(H,9,10);4H,1-3H3 |
| InChIKey | GFEQMJGMLUJWKK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;3-fluoro-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;3-fluoro-2H-indazole?
The IUPAC name of tert-butyl formate;3-fluoro-2H-indazole (CID 158237907) is tert-butyl formate;3-fluoro-2H-indazole.
What is the SMILES notation for tert-butyl formate;3-fluoro-2H-indazole?
The canonical SMILES for tert-butyl formate;3-fluoro-2H-indazole is CC(C)(C)OC=O.Fc1[nH]nc2ccccc12.
What is the InChIKey of tert-butyl formate;3-fluoro-2H-indazole?
The InChIKey is GFEQMJGMLUJWKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN2.C5H10O2/c8-7-5-3-1-2-4-6(5)9-10-7;1-5(2,3)7-4-6/h1-4H,(H,9,10);4H,1-3H3.
What are the key properties of tert-butyl formate;3-fluoro-2H-indazole?
tert-butyl formate;3-fluoro-2H-indazole has a molecular weight of 238.26 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;3-fluoro-2H-indazole is sourced from PubChem (CID 158237907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).