C15H14BrN3 — CID 177034353
N-(4-bromo-2,5-dimethylphenyl)-1H-indazol-3-amine (PubChem CID 177034353) has the molecular formula C15H14BrN3 and a molecular weight of 316.20 g/mol. Its IUPAC name is N-(4-bromo-2,5-dimethylphenyl)-1H-indazol-3-amine.
| Compound Name | N-(4-bromo-2,5-dimethylphenyl)-1H-indazol-3-amine |
|---|---|
| PubChem CID | 177034353 |
| Molecular Formula | C15H14BrN3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-(4-bromo-2,5-dimethylphenyl)-1H-indazol-3-amine |
| SMILES | Cc1cc(Nc2n[nH]c3ccccc23)c(C)cc1Br |
| InChI | InChI=1S/C15H14BrN3/c1-9-8-14(10(2)7-12(9)16)17-15-11-5-3-4-6-13(11)18-19-15/h3-8H,1-2H3,(H2,17,18,19) |
| InChIKey | KTKVHHSRTRONEV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |