C19H18ClN3OS — CID 110645471
1-[2-(5-benzyl-1,3-thiazol-2-yl)ethyl]-3-(4-chlorophenyl)urea (PubChem CID 110645471) has the molecular formula C19H18ClN3OS and a molecular weight of 371.89 g/mol. Its IUPAC name is 1-[2-(5-benzyl-1,3-thiazol-2-yl)ethyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[2-(5-benzyl-1,3-thiazol-2-yl)ethyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 110645471 |
| Molecular Formula | C19H18ClN3OS |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 1-[2-(5-benzyl-1,3-thiazol-2-yl)ethyl]-3-(4-chlorophenyl)urea |
| SMILES | O=C(NCCc1ncc(Cc2ccccc2)s1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClN3OS/c20-15-6-8-16(9-7-15)23-19(24)21-11-10-18-22-13-17(25-18)12-14-4-2-1-3-5-14/h1-9,13H,10-12H2,(H2,21,23,24) |
| InChIKey | NPURZSSHJTVZRC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |