C19H25N3OS — CID 110645469
1-[2-(5-benzyl-1,3-thiazol-2-yl)ethyl]-3-cyclohexylurea (PubChem CID 110645469) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is 1-[2-(5-benzyl-1,3-thiazol-2-yl)ethyl]-3-cyclohexylurea.
| Compound Name | 1-[2-(5-benzyl-1,3-thiazol-2-yl)ethyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 110645469 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1-[2-(5-benzyl-1,3-thiazol-2-yl)ethyl]-3-cyclohexylurea |
| SMILES | O=C(NCCc1ncc(Cc2ccccc2)s1)NC1CCCCC1 |
| InChI | InChI=1S/C19H25N3OS/c23-19(22-16-9-5-2-6-10-16)20-12-11-18-21-14-17(24-18)13-15-7-3-1-4-8-15/h1,3-4,7-8,14,16H,2,5-6,9-13H2,(H2,20,22,23) |
| InChIKey | GVLOROCFNIGUGT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |