About 4-(4-aminophenyl)aniline;prop-2-enylbenzene
4-(4-aminophenyl)aniline;prop-2-enylbenzene (PubChem CID 175268611) has the molecular formula C21H22N2
and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-(4-aminophenyl)aniline;prop-2-enylbenzene.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)aniline;prop-2-enylbenzene |
| PubChem CID | 175268611 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 4-(4-aminophenyl)aniline;prop-2-enylbenzene |
| SMILES | C=CCc1ccccc1.Nc1ccc(-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C12H12N2.C9H10/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2-6-9-7-4-3-5-8-9/h1-8H,13-14H2;2-5,7-8H,1,6H2 |
| InChIKey | RHRDVUJWWKASNF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)aniline;prop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)aniline;prop-2-enylbenzene?
The IUPAC name of 4-(4-aminophenyl)aniline;prop-2-enylbenzene (CID 175268611) is 4-(4-aminophenyl)aniline;prop-2-enylbenzene.
What is the SMILES notation for 4-(4-aminophenyl)aniline;prop-2-enylbenzene?
The canonical SMILES for 4-(4-aminophenyl)aniline;prop-2-enylbenzene is C=CCc1ccccc1.Nc1ccc(-c2ccc(N)cc2)cc1.
What is the InChIKey of 4-(4-aminophenyl)aniline;prop-2-enylbenzene?
The InChIKey is RHRDVUJWWKASNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.C9H10/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2-6-9-7-4-3-5-8-9/h1-8H,13-14H2;2-5,7-8H,1,6H2.
What are the key properties of 4-(4-aminophenyl)aniline;prop-2-enylbenzene?
4-(4-aminophenyl)aniline;prop-2-enylbenzene has a molecular weight of 302.42 g/mol, XLogP of 4.93, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)aniline;prop-2-enylbenzene is sourced from PubChem (CID 175268611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).