C11H9N3S — CID 140907479
[2-(4-isocyanophenyl)-1,3-thiazol-5-yl]methanamine (PubChem CID 140907479) has the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. Its IUPAC name is [2-(4-isocyanophenyl)-1,3-thiazol-5-yl]methanamine.
| Compound Name | [2-(4-isocyanophenyl)-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 140907479 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | [2-(4-isocyanophenyl)-1,3-thiazol-5-yl]methanamine |
| SMILES | [C-]#[N+]c1ccc(-c2ncc(CN)s2)cc1 |
| InChI | InChI=1S/C11H9N3S/c1-13-9-4-2-8(3-5-9)11-14-7-10(6-12)15-11/h2-5,7H,6,12H2 |
| InChIKey | HVNJBTDESQVGPO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 43.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|