C10H11N3OS — CID 114938155
[2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]methanamine (PubChem CID 114938155) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is [2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]methanamine.
| Compound Name | [2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 114938155 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | [2-(6-methoxy-3-pyridinyl)-1,3-thiazol-5-yl]methanamine |
| SMILES | COc1ccc(-c2ncc(CN)s2)cn1 |
| InChI | InChI=1S/C10H11N3OS/c1-14-9-3-2-7(5-12-9)10-13-6-8(4-11)15-10/h2-3,5-6H,4,11H2,1H3 |
| InChIKey | PTLABSSOYCCKSA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |