C14H14ClNOS — CID 82431610
1-[2-(4-chlorophenyl)-4-propyl-1,3-thiazol-5-yl]ethanone (PubChem CID 82431610) has the molecular formula C14H14ClNOS and a molecular weight of 279.79 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-4-propyl-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(4-chlorophenyl)-4-propyl-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 82431610 |
| Molecular Formula | C14H14ClNOS |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-4-propyl-1,3-thiazol-5-yl]ethanone |
| SMILES | CCCc1nc(-c2ccc(Cl)cc2)sc1C(C)=O |
| InChI | InChI=1S/C14H14ClNOS/c1-3-4-12-13(9(2)17)18-14(16-12)10-5-7-11(15)8-6-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | CPIWITGFXHXQIO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |