C17H21NOS — CID 82430136
1-[2-(4-tert-butylphenyl)-4-ethyl-1,3-thiazol-5-yl]ethanone (PubChem CID 82430136) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)-4-ethyl-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(4-tert-butylphenyl)-4-ethyl-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 82430136 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)-4-ethyl-1,3-thiazol-5-yl]ethanone |
| SMILES | CCc1nc(-c2ccc(C(C)(C)C)cc2)sc1C(C)=O |
| InChI | InChI=1S/C17H21NOS/c1-6-14-15(11(2)19)20-16(18-14)12-7-9-13(10-8-12)17(3,4)5/h7-10H,6H2,1-5H3 |
| InChIKey | ZABBECIPBDNHNS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |