C11H11NOS2 — CID 82430291
1-(4-ethyl-2-thiophen-2-yl-1,3-thiazol-5-yl)ethanone (PubChem CID 82430291) has the molecular formula C11H11NOS2 and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-(4-ethyl-2-thiophen-2-yl-1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(4-ethyl-2-thiophen-2-yl-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 82430291 |
| Molecular Formula | C11H11NOS2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 1-(4-ethyl-2-thiophen-2-yl-1,3-thiazol-5-yl)ethanone |
| SMILES | CCc1nc(-c2cccs2)sc1C(C)=O |
| InChI | InChI=1S/C11H11NOS2/c1-3-8-10(7(2)13)15-11(12-8)9-5-4-6-14-9/h4-6H,3H2,1-2H3 |
| InChIKey | XRHAUHRJHMDXFZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |