C12H13NO2S2 — CID 118609248
1-(4-methoxy-2-thiophen-2-yl-1,3-thiazol-5-yl)butan-1-one (PubChem CID 118609248) has the molecular formula C12H13NO2S2 and a molecular weight of 267.38 g/mol. Its IUPAC name is 1-(4-methoxy-2-thiophen-2-yl-1,3-thiazol-5-yl)butan-1-one.
| Compound Name | 1-(4-methoxy-2-thiophen-2-yl-1,3-thiazol-5-yl)butan-1-one |
|---|---|
| PubChem CID | 118609248 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 1-(4-methoxy-2-thiophen-2-yl-1,3-thiazol-5-yl)butan-1-one |
| SMILES | CCCC(=O)c1sc(-c2cccs2)nc1OC |
| InChI | InChI=1S/C12H13NO2S2/c1-3-5-8(14)10-11(15-2)13-12(17-10)9-6-4-7-16-9/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | AMVLBGLAVBMTKZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |