C10H10N2S3 — CID 82430275
4-ethyl-2-thiophen-2-yl-1,3-thiazole-5-carbothioamide (PubChem CID 82430275) has the molecular formula C10H10N2S3 and a molecular weight of 254.41 g/mol. Its IUPAC name is 4-ethyl-2-thiophen-2-yl-1,3-thiazole-5-carbothioamide.
| Compound Name | 4-ethyl-2-thiophen-2-yl-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82430275 |
| Molecular Formula | C10H10N2S3 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 4-ethyl-2-thiophen-2-yl-1,3-thiazole-5-carbothioamide |
| SMILES | CCc1nc(-c2cccs2)sc1C(N)=S |
| InChI | InChI=1S/C10H10N2S3/c1-2-6-8(9(11)13)15-10(12-6)7-4-3-5-14-7/h3-5H,2H2,1H3,(H2,11,13) |
| InChIKey | IXSQAHKBNCRYKE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|