C7H10N2S2 — CID 82428114
4-ethyl-2-methyl-1,3-thiazole-5-carbothioamide (PubChem CID 82428114) has the molecular formula C7H10N2S2 and a molecular weight of 186.31 g/mol. Its IUPAC name is 4-ethyl-2-methyl-1,3-thiazole-5-carbothioamide.
| Compound Name | 4-ethyl-2-methyl-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82428114 |
| Molecular Formula | C7H10N2S2 |
| Molecular Weight | 186.31 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 4-ethyl-2-methyl-1,3-thiazole-5-carbothioamide |
| SMILES | CCc1nc(C)sc1C(N)=S |
| InChI | InChI=1S/C7H10N2S2/c1-3-5-6(7(8)10)11-4(2)9-5/h3H2,1-2H3,(H2,8,10) |
| InChIKey | GWMLLBJBRQWVOQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|