C15H18N2OS2 — CID 82428859
4-ethyl-2-[(4-ethylphenoxy)methyl]-1,3-thiazole-5-carbothioamide (PubChem CID 82428859) has the molecular formula C15H18N2OS2 and a molecular weight of 306.46 g/mol. Its IUPAC name is 4-ethyl-2-[(4-ethylphenoxy)methyl]-1,3-thiazole-5-carbothioamide.
| Compound Name | 4-ethyl-2-[(4-ethylphenoxy)methyl]-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82428859 |
| Molecular Formula | C15H18N2OS2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-ethyl-2-[(4-ethylphenoxy)methyl]-1,3-thiazole-5-carbothioamide |
| SMILES | CCc1ccc(OCc2nc(CC)c(C(N)=S)s2)cc1 |
| InChI | InChI=1S/C15H18N2OS2/c1-3-10-5-7-11(8-6-10)18-9-13-17-12(4-2)14(20-13)15(16)19/h5-8H,3-4,9H2,1-2H3,(H2,16,19) |
| InChIKey | LOJWRMCOHINKTA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|