C9H15N3S2 — CID 82430404
2-[(dimethylamino)methyl]-4-ethyl-1,3-thiazole-5-carbothioamide (PubChem CID 82430404) has the molecular formula C9H15N3S2 and a molecular weight of 229.37 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-4-ethyl-1,3-thiazole-5-carbothioamide.
| Compound Name | 2-[(dimethylamino)methyl]-4-ethyl-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82430404 |
| Molecular Formula | C9H15N3S2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-[(dimethylamino)methyl]-4-ethyl-1,3-thiazole-5-carbothioamide |
| SMILES | CCc1nc(CN(C)C)sc1C(N)=S |
| InChI | InChI=1S/C9H15N3S2/c1-4-6-8(9(10)13)14-7(11-6)5-12(2)3/h4-5H2,1-3H3,(H2,10,13) |
| InChIKey | LFQLFIGYRQVOBH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|