C12H21N3S2 — CID 82435210
2-(diethylaminomethyl)-4-propan-2-yl-1,3-thiazole-5-carbothioamide (PubChem CID 82435210) has the molecular formula C12H21N3S2 and a molecular weight of 271.46 g/mol. Its IUPAC name is 2-(diethylaminomethyl)-4-propan-2-yl-1,3-thiazole-5-carbothioamide.
| Compound Name | 2-(diethylaminomethyl)-4-propan-2-yl-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82435210 |
| Molecular Formula | C12H21N3S2 |
| Molecular Weight | 271.46 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-(diethylaminomethyl)-4-propan-2-yl-1,3-thiazole-5-carbothioamide |
| SMILES | CCN(CC)Cc1nc(C(C)C)c(C(N)=S)s1 |
| InChI | InChI=1S/C12H21N3S2/c1-5-15(6-2)7-9-14-10(8(3)4)11(17-9)12(13)16/h8H,5-7H2,1-4H3,(H2,13,16) |
| InChIKey | BGKYENGLQBPWSJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|