C9H15N3S — CID 82428484
4-ethyl-2-propyl-1,3-thiazole-5-carboximidamide (PubChem CID 82428484) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 4-ethyl-2-propyl-1,3-thiazole-5-carboximidamide.
| Compound Name | 4-ethyl-2-propyl-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 82428484 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 4-ethyl-2-propyl-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1sc(CCC)nc1CC |
| InChI | InChI=1S/C9H15N3S/c1-3-5-7-12-6(4-2)8(13-7)9(10)11/h3-5H2,1-2H3,(H3,10,11) |
| InChIKey | RBPOJQBKGCQYLK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|