C12H20N4S — CID 82431120
2-(azepan-1-yl)-4-ethyl-1,3-thiazole-5-carboximidamide (PubChem CID 82431120) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is 2-(azepan-1-yl)-4-ethyl-1,3-thiazole-5-carboximidamide.
| Compound Name | 2-(azepan-1-yl)-4-ethyl-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 82431120 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-(azepan-1-yl)-4-ethyl-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1sc(N2CCCCCC2)nc1CC |
| InChI | InChI=1S/C12H20N4S/c1-2-9-10(11(13)14)17-12(15-9)16-7-5-3-4-6-8-16/h2-8H2,1H3,(H3,13,14) |
| InChIKey | LTIPMVHRJOIBJE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|