C10H16N2OS2 — CID 62778641
(4-ethyl-2-thiomorpholin-4-yl-1,3-thiazol-5-yl)methanol (PubChem CID 62778641) has the molecular formula C10H16N2OS2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (4-ethyl-2-thiomorpholin-4-yl-1,3-thiazol-5-yl)methanol.
| Compound Name | (4-ethyl-2-thiomorpholin-4-yl-1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 62778641 |
| Molecular Formula | C10H16N2OS2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (4-ethyl-2-thiomorpholin-4-yl-1,3-thiazol-5-yl)methanol |
| SMILES | CCc1nc(N2CCSCC2)sc1CO |
| InChI | InChI=1S/C10H16N2OS2/c1-2-8-9(7-13)15-10(11-8)12-3-5-14-6-4-12/h13H,2-7H2,1H3 |
| InChIKey | DTVCYWWOVZSGAY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |