C12H20N4OS — CID 82441854
4-(methoxymethyl)-2-(2-methylpiperidin-1-yl)-1,3-thiazole-5-carboximidamide (PubChem CID 82441854) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is 4-(methoxymethyl)-2-(2-methylpiperidin-1-yl)-1,3-thiazole-5-carboximidamide.
| Compound Name | 4-(methoxymethyl)-2-(2-methylpiperidin-1-yl)-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 82441854 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-(methoxymethyl)-2-(2-methylpiperidin-1-yl)-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1sc(N2CCCCC2C)nc1COC |
| InChI | InChI=1S/C12H20N4OS/c1-8-5-3-4-6-16(8)12-15-9(7-17-2)10(18-12)11(13)14/h8H,3-7H2,1-2H3,(H3,13,14) |
| InChIKey | IAEMBKUINAMCPG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|