C9H15N3OS — CID 82440152
4-(methoxymethyl)-2-propyl-1,3-thiazole-5-carboximidamide (PubChem CID 82440152) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 4-(methoxymethyl)-2-propyl-1,3-thiazole-5-carboximidamide.
| Compound Name | 4-(methoxymethyl)-2-propyl-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 82440152 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 4-(methoxymethyl)-2-propyl-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1sc(CCC)nc1COC |
| InChI | InChI=1S/C9H15N3OS/c1-3-4-7-12-6(5-13-2)8(14-7)9(10)11/h3-5H2,1-2H3,(H3,10,11) |
| InChIKey | NRJAMQMDFBEGFY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|