C9H16N4S — CID 82427595
2-[2-(dimethylamino)ethyl]-4-methyl-1,3-thiazole-5-carboximidamide (PubChem CID 82427595) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-4-methyl-1,3-thiazole-5-carboximidamide.
| Compound Name | 2-[2-(dimethylamino)ethyl]-4-methyl-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 82427595 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-4-methyl-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1sc(CCN(C)C)nc1C |
| InChI | InChI=1S/C9H16N4S/c1-6-8(9(10)11)14-7(12-6)4-5-13(2)3/h4-5H2,1-3H3,(H3,10,11) |
| InChIKey | MIJLOMNJBZYLCL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|