C13H14N2S2 — CID 82428384
2-benzyl-4-ethyl-1,3-thiazole-5-carbothioamide (PubChem CID 82428384) has the molecular formula C13H14N2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-benzyl-4-ethyl-1,3-thiazole-5-carbothioamide.
| Compound Name | 2-benzyl-4-ethyl-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82428384 |
| Molecular Formula | C13H14N2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-benzyl-4-ethyl-1,3-thiazole-5-carbothioamide |
| SMILES | CCc1nc(Cc2ccccc2)sc1C(N)=S |
| InChI | InChI=1S/C13H14N2S2/c1-2-10-12(13(14)16)17-11(15-10)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H2,14,16) |
| InChIKey | XGKPEBVWXFGDDQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|