C9H8N2S3 — CID 82427273
4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbothioamide (PubChem CID 82427273) has the molecular formula C9H8N2S3 and a molecular weight of 240.38 g/mol. Its IUPAC name is 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbothioamide.
| Compound Name | 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82427273 |
| Molecular Formula | C9H8N2S3 |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbothioamide |
| SMILES | Cc1nc(-c2cccs2)sc1C(N)=S |
| InChI | InChI=1S/C9H8N2S3/c1-5-7(8(10)12)14-9(11-5)6-3-2-4-13-6/h2-4H,1H3,(H2,10,12) |
| InChIKey | MPTDVGXGAIMPBA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|