C9H9NOS2 — CID 116887500
5-methoxy-4-methyl-2-thiophen-2-yl-1,3-thiazole (PubChem CID 116887500) has the molecular formula C9H9NOS2 and a molecular weight of 211.31 g/mol. Its IUPAC name is 5-methoxy-4-methyl-2-thiophen-2-yl-1,3-thiazole.
| Compound Name | 5-methoxy-4-methyl-2-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 116887500 |
| Molecular Formula | C9H9NOS2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 5-methoxy-4-methyl-2-thiophen-2-yl-1,3-thiazole |
| SMILES | COc1sc(-c2cccs2)nc1C |
| InChI | InChI=1S/C9H9NOS2/c1-6-9(11-2)13-8(10-6)7-4-3-5-12-7/h3-5H,1-2H3 |
| InChIKey | HPQZBCJPVAPFSK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |