C11H10FNOS — CID 116887509
2-(4-fluorophenyl)-5-methoxy-4-methyl-1,3-thiazole (PubChem CID 116887509) has the molecular formula C11H10FNOS and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-methoxy-4-methyl-1,3-thiazole.
| Compound Name | 2-(4-fluorophenyl)-5-methoxy-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 116887509 |
| Molecular Formula | C11H10FNOS |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2-(4-fluorophenyl)-5-methoxy-4-methyl-1,3-thiazole |
| SMILES | COc1sc(-c2ccc(F)cc2)nc1C |
| InChI | InChI=1S/C11H10FNOS/c1-7-11(14-2)15-10(13-7)8-3-5-9(12)6-4-8/h3-6H,1-2H3 |
| InChIKey | UTQMLWZLEGVLFH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |