C13H15NO2S — CID 116887536
2-(4-ethoxyphenyl)-5-methoxy-4-methyl-1,3-thiazole (PubChem CID 116887536) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-5-methoxy-4-methyl-1,3-thiazole.
| Compound Name | 2-(4-ethoxyphenyl)-5-methoxy-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 116887536 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-(4-ethoxyphenyl)-5-methoxy-4-methyl-1,3-thiazole |
| SMILES | CCOc1ccc(-c2nc(C)c(OC)s2)cc1 |
| InChI | InChI=1S/C13H15NO2S/c1-4-16-11-7-5-10(6-8-11)12-14-9(2)13(15-3)17-12/h5-8H,4H2,1-3H3 |
| InChIKey | BNVNMXONLCDOIJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |