C10H8FNOS — CID 116886009
2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-ol (PubChem CID 116886009) has the molecular formula C10H8FNOS and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-ol.
| Compound Name | 2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-ol |
|---|---|
| PubChem CID | 116886009 |
| Molecular Formula | C10H8FNOS |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-ol |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1O |
| InChI | InChI=1S/C10H8FNOS/c1-6-10(13)14-9(12-6)7-2-4-8(11)5-3-7/h2-5,13H,1H3 |
| InChIKey | WSGBYFZGXZZNLJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |