C19H14FNO2S — CID 135812135
(E)-3-(4-fluorophenyl)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]prop-2-en-1-one (PubChem CID 135812135) has the molecular formula C19H14FNO2S and a molecular weight of 339.39 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-fluorophenyl)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135812135 |
| Molecular Formula | C19H14FNO2S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]prop-2-en-1-one |
| SMILES | Cc1nc(-c2ccc(O)cc2)sc1C(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C19H14FNO2S/c1-12-18(17(23)11-4-13-2-7-15(20)8-3-13)24-19(21-12)14-5-9-16(22)10-6-14/h2-11,22H,1H3/b11-4+ |
| InChIKey | BIHVBBAFTDBWLV-NYYWCZLTSA-N |
| XLogP | 4.86 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|