C19H15NO3S — CID 135812145
(E)-3-(3-hydroxyphenyl)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]prop-2-en-1-one (PubChem CID 135812145) has the molecular formula C19H15NO3S and a molecular weight of 337.40 g/mol. Its IUPAC name is (E)-3-(3-hydroxyphenyl)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-hydroxyphenyl)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135812145 |
| Molecular Formula | C19H15NO3S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (E)-3-(3-hydroxyphenyl)-1-[2-(4-hydroxyphenyl)-4-methyl-1,3-thiazol-5-yl]prop-2-en-1-one |
| SMILES | Cc1nc(-c2ccc(O)cc2)sc1C(=O)/C=C/c1cccc(O)c1 |
| InChI | InChI=1S/C19H15NO3S/c1-12-18(17(23)10-5-13-3-2-4-16(22)11-13)24-19(20-12)14-6-8-15(21)9-7-14/h2-11,21-22H,1H3/b10-5+ |
| InChIKey | SXQRFEYVMGSMMU-BJMVGYQFSA-N |
| XLogP | 4.43 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|