C26H18N4O6S2 — CID 5466743
(E)-1-[4-methyl-2-[4-methyl-5-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]-3-(4-nitrophenyl)prop-2-en-1-one (PubChem CID 5466743) has the molecular formula C26H18N4O6S2 and a molecular weight of 546.59 g/mol. Its IUPAC name is (E)-1-[4-methyl-2-[4-methyl-5-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]-3-(4-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-methyl-2-[4-methyl-5-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]-3-(4-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5466743 |
| Molecular Formula | C26H18N4O6S2 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | (E)-1-[4-methyl-2-[4-methyl-5-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-1,3-thiazol-2-yl]-1,3-thiazol-5-yl]-3-(4-nitrophenyl)prop-2-en-1-one |
| SMILES | Cc1nc(-c2nc(C)c(C(=O)/C=C/c3ccc([N+](=O)[O-])cc3)s2)sc1C(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H18N4O6S2/c1-15-23(21(31)13-7-17-3-9-19(10-4-17)29(33)34)37-25(27-15)26-28-16(2)24(38-26)22(32)14-8-18-5-11-20(12-6-18)30(35)36/h3-14H,1-2H3/b13-7+,14-8+ |
| InChIKey | QCWZBSFMTXYXNZ-FNCQTZNRSA-N |
| XLogP | 6.49 |
| TPSA | 146.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|