C14H12N4O3S2 — CID 4162863
[4-methyl-5-[3-(3-nitrophenyl)prop-2-enoyl]-1,3-thiazol-2-yl]thiourea (PubChem CID 4162863) has the molecular formula C14H12N4O3S2 and a molecular weight of 348.41 g/mol. Its IUPAC name is [4-methyl-5-[3-(3-nitrophenyl)prop-2-enoyl]-1,3-thiazol-2-yl]thiourea.
| Compound Name | [4-methyl-5-[3-(3-nitrophenyl)prop-2-enoyl]-1,3-thiazol-2-yl]thiourea |
|---|---|
| PubChem CID | 4162863 |
| Molecular Formula | C14H12N4O3S2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | [4-methyl-5-[3-(3-nitrophenyl)prop-2-enoyl]-1,3-thiazol-2-yl]thiourea |
| SMILES | Cc1nc(NC(N)=S)sc1C(=O)C=Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12N4O3S2/c1-8-12(23-14(16-8)17-13(15)22)11(19)6-5-9-3-2-4-10(7-9)18(20)21/h2-7H,1H3,(H3,15,16,17,22) |
| InChIKey | FYGMLLCYSLYVSV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|