C16H18N8O3S2 — CID 135499277
1-[(E)-[(E)-1-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-(3-nitrophenyl)prop-2-enylidene]amino]-3-aminothiourea (PubChem CID 135499277) has the molecular formula C16H18N8O3S2 and a molecular weight of 434.51 g/mol. Its IUPAC name is 1-[(E)-[(E)-1-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-(3-nitrophenyl)prop-2-enylidene]amino]-3-aminothiourea.
| Compound Name | 1-[(E)-[(E)-1-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-(3-nitrophenyl)prop-2-enylidene]amino]-3-aminothiourea |
|---|---|
| PubChem CID | 135499277 |
| Molecular Formula | C16H18N8O3S2 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 1-[(E)-[(E)-1-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-(3-nitrophenyl)prop-2-enylidene]amino]-3-aminothiourea |
| SMILES | CC(=O)NNc1nc(C)c(C(/C=C/c2cccc([N+](=O)[O-])c2)=N/NC(=S)NN)s1 |
| InChI | InChI=1S/C16H18N8O3S2/c1-9-14(29-16(18-9)23-20-10(2)25)13(21-22-15(28)19-17)7-6-11-4-3-5-12(8-11)24(26)27/h3-8H,17H2,1-2H3,(H,18,23)(H,20,25)(H2,19,22,28)/b7-6+,21-13+ |
| InChIKey | FDKQKUSMOURFJK-XKVYGDKHSA-N |
| XLogP | 1.58 |
| TPSA | 159.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|