C18H12N4O3S2 — CID 6156088
(E)-N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 6156088) has the molecular formula C18H12N4O3S2 and a molecular weight of 396.45 g/mol. Its IUPAC name is (E)-N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6156088 |
| Molecular Formula | C18H12N4O3S2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | (E)-N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | Cc1nc2c(ccc3nc(NC(=O)/C=C/c4cccc([N+](=O)[O-])c4)sc32)s1 |
| InChI | InChI=1S/C18H12N4O3S2/c1-10-19-16-14(26-10)7-6-13-17(16)27-18(20-13)21-15(23)8-5-11-3-2-4-12(9-11)22(24)25/h2-9H,1H3,(H,20,21,23)/b8-5+ |
| InChIKey | LLPLEZTYNDQVCZ-VMPITWQZSA-N |
| XLogP | 4.77 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|