C14H8N4O3S3 — CID 4110990
N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide (PubChem CID 4110990) has the molecular formula C14H8N4O3S3 and a molecular weight of 376.44 g/mol. Its IUPAC name is N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide.
| Compound Name | N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4110990 |
| Molecular Formula | C14H8N4O3S3 |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide |
| SMILES | Cc1nc2c(ccc3nc(NC(=O)c4ccc([N+](=O)[O-])s4)sc32)s1 |
| InChI | InChI=1S/C14H8N4O3S3/c1-6-15-11-8(22-6)3-2-7-12(11)24-14(16-7)17-13(19)9-4-5-10(23-9)18(20)21/h2-5H,1H3,(H,16,17,19) |
| InChIKey | NGCIBXOFOOSZHV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|