C18H12N4O3S3 — CID 41056954
(3aR,7aR)-N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-5-nitro-3a,7a-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 41056954) has the molecular formula C18H12N4O3S3 and a molecular weight of 428.52 g/mol. Its IUPAC name is (3aR,7aR)-N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-5-nitro-3a,7a-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | (3aR,7aR)-N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-5-nitro-3a,7a-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 41056954 |
| Molecular Formula | C18H12N4O3S3 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | (3aR,7aR)-N-(7-methyl-[1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)-5-nitro-3a,7a-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1nc2c(ccc3nc(NC(=O)C4=C[C@H]5C=C([N+](=O)[O-])C=C[C@H]5S4)sc32)s1 |
| InChI | InChI=1S/C18H12N4O3S3/c1-8-19-15-13(26-8)5-3-11-16(15)28-18(20-11)21-17(23)14-7-9-6-10(22(24)25)2-4-12(9)27-14/h2-7,9,12H,1H3,(H,20,21,23)/t9-,12-/m1/s1 |
| InChIKey | WWRSEKRPCDTFIH-BXKDBHETSA-N |
| XLogP | 4.50 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|