C29H23N7O2S2 — CID 98557704
[(E)-[(Z)-1-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]-3-(4-nitrophenyl)prop-2-enylidene]amino]thiourea (PubChem CID 98557704) has the molecular formula C29H23N7O2S2 and a molecular weight of 565.68 g/mol. Its IUPAC name is [(E)-[(Z)-1-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]-3-(4-nitrophenyl)prop-2-enylidene]amino]thiourea.
| Compound Name | [(E)-[(Z)-1-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]-3-(4-nitrophenyl)prop-2-enylidene]amino]thiourea |
|---|---|
| PubChem CID | 98557704 |
| Molecular Formula | C29H23N7O2S2 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | [(E)-[(Z)-1-[2-(3,5-diphenylpyrazol-1-yl)-4-methyl-1,3-thiazol-5-yl]-3-(4-nitrophenyl)prop-2-enylidene]amino]thiourea |
| SMILES | Cc1nc(-n2nc(-c3ccccc3)cc2-c2ccccc2)sc1C(/C=C\c1ccc([N+](=O)[O-])cc1)=N/NC(N)=S |
| InChI | InChI=1S/C29H23N7O2S2/c1-19-27(24(32-33-28(30)39)17-14-20-12-15-23(16-13-20)36(37)38)40-29(31-19)35-26(22-10-6-3-7-11-22)18-25(34-35)21-8-4-2-5-9-21/h2-18H,1H3,(H3,30,33,39)/b17-14-,32-24+ |
| InChIKey | XAZIYJYEOSJEBK-WHRMNIKVSA-N |
| XLogP | 6.13 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|