C26H20N6O6S — CID 135965765
2-hydroxy-N-[(Z)-[(E)-1-[4-methyl-2-(4-nitroanilino)-1,3-thiazol-5-yl]-3-(4-nitrophenyl)prop-2-enylidene]amino]benzamide (PubChem CID 135965765) has the molecular formula C26H20N6O6S and a molecular weight of 544.55 g/mol. Its IUPAC name is 2-hydroxy-N-[(Z)-[(E)-1-[4-methyl-2-(4-nitroanilino)-1,3-thiazol-5-yl]-3-(4-nitrophenyl)prop-2-enylidene]amino]benzamide.
| Compound Name | 2-hydroxy-N-[(Z)-[(E)-1-[4-methyl-2-(4-nitroanilino)-1,3-thiazol-5-yl]-3-(4-nitrophenyl)prop-2-enylidene]amino]benzamide |
|---|---|
| PubChem CID | 135965765 |
| Molecular Formula | C26H20N6O6S |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | 2-hydroxy-N-[(Z)-[(E)-1-[4-methyl-2-(4-nitroanilino)-1,3-thiazol-5-yl]-3-(4-nitrophenyl)prop-2-enylidene]amino]benzamide |
| SMILES | Cc1nc(Nc2ccc([N+](=O)[O-])cc2)sc1C(/C=C/c1ccc([N+](=O)[O-])cc1)=N\NC(=O)c1ccccc1O |
| InChI | InChI=1S/C26H20N6O6S/c1-16-24(39-26(27-16)28-18-9-13-20(14-10-18)32(37)38)22(15-8-17-6-11-19(12-7-17)31(35)36)29-30-25(34)21-4-2-3-5-23(21)33/h2-15,33H,1H3,(H,27,28)(H,30,34)/b15-8+,29-22- |
| InChIKey | GSPXWWXIQGNJID-YAHFBHQASA-N |
| XLogP | 5.56 |
| TPSA | 172.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|