C19H19BrN4O4S — CID 172724001
2-(4-bromoanilino)-4-methyl-1,3-thiazole-5-carboxylic acid;(1R)-1-(4-nitrophenyl)ethanamine (PubChem CID 172724001) has the molecular formula C19H19BrN4O4S and a molecular weight of 479.36 g/mol. Its IUPAC name is 2-(4-bromoanilino)-4-methyl-1,3-thiazole-5-carboxylic acid;(1R)-1-(4-nitrophenyl)ethanamine.
| Compound Name | 2-(4-bromoanilino)-4-methyl-1,3-thiazole-5-carboxylic acid;(1R)-1-(4-nitrophenyl)ethanamine |
|---|---|
| PubChem CID | 172724001 |
| Molecular Formula | C19H19BrN4O4S |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | 2-(4-bromoanilino)-4-methyl-1,3-thiazole-5-carboxylic acid;(1R)-1-(4-nitrophenyl)ethanamine |
| SMILES | C[C@@H](N)c1ccc([N+](=O)[O-])cc1.Cc1nc(Nc2ccc(Br)cc2)sc1C(=O)O |
| InChI | InChI=1S/C11H9BrN2O2S.C8H10N2O2/c1-6-9(10(15)16)17-11(13-6)14-8-4-2-7(12)3-5-8;1-6(9)7-2-4-8(5-3-7)10(11)12/h2-5H,1H3,(H,13,14)(H,15,16);2-6H,9H2,1H3/t;6-/m.1/s1 |
| InChIKey | GWYHOYDNMRGENO-FCXZQVPUSA-N |
| XLogP | 5.27 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|