C17H14N6O5S — CID 3837233
2-anilino-N'-(2,4-dinitrophenyl)-4-methyl-1,3-thiazole-5-carbohydrazide (PubChem CID 3837233) has the molecular formula C17H14N6O5S and a molecular weight of 414.40 g/mol. Its IUPAC name is 2-anilino-N'-(2,4-dinitrophenyl)-4-methyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-anilino-N'-(2,4-dinitrophenyl)-4-methyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 3837233 |
| Molecular Formula | C17H14N6O5S |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2-anilino-N'-(2,4-dinitrophenyl)-4-methyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(Nc2ccccc2)sc1C(=O)NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N6O5S/c1-10-15(29-17(18-10)19-11-5-3-2-4-6-11)16(24)21-20-13-8-7-12(22(25)26)9-14(13)23(27)28/h2-9,20H,1H3,(H,18,19)(H,21,24) |
| InChIKey | NBURCQUYRPUOQB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 152.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|