C16H18N6OS2 — CID 135751885
[(E)-[1-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-phenylprop-2-enylidene]amino]thiourea (PubChem CID 135751885) has the molecular formula C16H18N6OS2 and a molecular weight of 374.50 g/mol. Its IUPAC name is [(E)-[1-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-phenylprop-2-enylidene]amino]thiourea.
| Compound Name | [(E)-[1-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-phenylprop-2-enylidene]amino]thiourea |
|---|---|
| PubChem CID | 135751885 |
| Molecular Formula | C16H18N6OS2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | [(E)-[1-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-phenylprop-2-enylidene]amino]thiourea |
| SMILES | CC(=O)NNc1nc(C)c(/C(C=Cc2ccccc2)=N/NC(N)=S)s1 |
| InChI | InChI=1S/C16H18N6OS2/c1-10-14(25-16(18-10)22-19-11(2)23)13(20-21-15(17)24)9-8-12-6-4-3-5-7-12/h3-9H,1-2H3,(H,18,22)(H,19,23)(H3,17,21,24)/b9-8?,20-13+ |
| InChIKey | DIVLUBBAUBISLN-SVYHSJCWSA-N |
| XLogP | 2.17 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|