C15H16N4O4S — CID 20835033
3-[(E)-3-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-oxoprop-1-enyl]-N-hydroxybenzeneamine oxide (PubChem CID 20835033) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is 3-[(E)-3-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-oxoprop-1-enyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[(E)-3-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-oxoprop-1-enyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 20835033 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 3-[(E)-3-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-oxoprop-1-enyl]-N-hydroxybenzeneamine oxide |
| SMILES | CC(=O)NNc1nc(C)c(C(=O)/C=C/c2cccc([NH+]([O-])O)c2)s1 |
| InChI | InChI=1S/C15H16N4O4S/c1-9-14(24-15(16-9)18-17-10(2)20)13(21)7-6-11-4-3-5-12(8-11)19(22)23/h3-8,19,22H,1-2H3,(H,16,18)(H,17,20)/b7-6+ |
| InChIKey | JDMIHADSSCHZKO-VOTSOKGWSA-N |
| XLogP | 1.21 |
| TPSA | 118.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|