C23H19FN4O3S2 — CID 6034064
N-[[5-[(E)-3-(4-acetamidophenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]carbamothioyl]-2-fluorobenzamide (PubChem CID 6034064) has the molecular formula C23H19FN4O3S2 and a molecular weight of 482.56 g/mol. Its IUPAC name is N-[[5-[(E)-3-(4-acetamidophenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]carbamothioyl]-2-fluorobenzamide.
| Compound Name | N-[[5-[(E)-3-(4-acetamidophenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]carbamothioyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 6034064 |
| Molecular Formula | C23H19FN4O3S2 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | N-[[5-[(E)-3-(4-acetamidophenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]carbamothioyl]-2-fluorobenzamide |
| SMILES | CC(=O)Nc1ccc(/C=C/C(=O)c2sc(NC(=S)NC(=O)c3ccccc3F)nc2C)cc1 |
| InChI | InChI=1S/C23H19FN4O3S2/c1-13-20(19(30)12-9-15-7-10-16(11-8-15)26-14(2)29)33-23(25-13)28-22(32)27-21(31)17-5-3-4-6-18(17)24/h3-12H,1-2H3,(H,26,29)(H2,25,27,28,31,32)/b12-9+ |
| InChIKey | OGJXKGKEARCSLI-FMIVXFBMSA-N |
| XLogP | 4.57 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|