C23H20FN3O4S2 — CID 3004253
N-[[5-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]carbamothioyl]-2-fluorobenzamide (PubChem CID 3004253) has the molecular formula C23H20FN3O4S2 and a molecular weight of 485.56 g/mol. Its IUPAC name is N-[[5-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]carbamothioyl]-2-fluorobenzamide.
| Compound Name | N-[[5-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]carbamothioyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 3004253 |
| Molecular Formula | C23H20FN3O4S2 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | N-[[5-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]carbamothioyl]-2-fluorobenzamide |
| SMILES | COc1ccc(C=CC(=O)c2sc(NC(=S)NC(=O)c3ccccc3F)nc2C)cc1OC |
| InChI | InChI=1S/C23H20FN3O4S2/c1-13-20(17(28)10-8-14-9-11-18(30-2)19(12-14)31-3)33-23(25-13)27-22(32)26-21(29)15-6-4-5-7-16(15)24/h4-12H,1-3H3,(H2,25,26,27,29,32) |
| InChIKey | OTRVKFZHUADVFF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|