C21H26N2O4S — CID 5199051
N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide (PubChem CID 5199051) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide.
| Compound Name | N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5199051 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide |
| SMILES | CCCCCOc1ccc(C=CC(=O)Nc2nc(C)c(C(C)=O)s2)cc1OC |
| InChI | InChI=1S/C21H26N2O4S/c1-5-6-7-12-27-17-10-8-16(13-18(17)26-4)9-11-19(25)23-21-22-14(2)20(28-21)15(3)24/h8-11,13H,5-7,12H2,1-4H3,(H,22,23,25) |
| InChIKey | IOOTZKDUTIRKCT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|