C18H23N7O2S2 — CID 4583546
N-[4-[3-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-(2-carbamothioylhydrazinyl)prop-1-enyl]phenyl]acetamide (PubChem CID 4583546) has the molecular formula C18H23N7O2S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-[4-[3-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-(2-carbamothioylhydrazinyl)prop-1-enyl]phenyl]acetamide.
| Compound Name | N-[4-[3-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-(2-carbamothioylhydrazinyl)prop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 4583546 |
| Molecular Formula | C18H23N7O2S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-[4-[3-[2-(2-acetylhydrazinyl)-4-methyl-1,3-thiazol-5-yl]-3-(2-carbamothioylhydrazinyl)prop-1-enyl]phenyl]acetamide |
| SMILES | CC(=O)NNc1nc(C)c(C(C=Cc2ccc(NC(C)=O)cc2)NNC(N)=S)s1 |
| InChI | InChI=1S/C18H23N7O2S2/c1-10-16(29-18(20-10)25-22-12(3)27)15(23-24-17(19)28)9-6-13-4-7-14(8-5-13)21-11(2)26/h4-9,15,23H,1-3H3,(H,20,25)(H,21,26)(H,22,27)(H3,19,24,28) |
| InChIKey | BGNWDZHUGHAPKP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|