C20H19N3O2S — CID 55519003
(E)-3-(4-acetamidophenyl)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 55519003) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is (E)-3-(4-acetamidophenyl)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-acetamidophenyl)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55519003 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (E)-3-(4-acetamidophenyl)-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(/C=C/C(=O)Nc2nc3c(C)ccc(C)c3s2)cc1 |
| InChI | InChI=1S/C20H19N3O2S/c1-12-4-5-13(2)19-18(12)23-20(26-19)22-17(25)11-8-15-6-9-16(10-7-15)21-14(3)24/h4-11H,1-3H3,(H,21,24)(H,22,23,25)/b11-8+ |
| InChIKey | KYEUQHBILPFBOZ-DHZHZOJOSA-N |
| XLogP | 4.52 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|